C27H43N9O8 — CID 25254069
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 25254069) has the molecular formula C27H43N9O8 and a molecular weight of 621.70 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 25254069 |
| Molecular Formula | C27H43N9O8 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@@H](N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H43N9O8/c28-11-5-4-10-18(26(43)44)35-24(41)19(13-16-7-2-1-3-8-16)36-25(42)20(14-22(38)39)34-21(37)15-33-23(40)17(29)9-6-12-32-27(30)31/h1-3,7-8,17-20H,4-6,9-15,28-29H2,(H,33,40)(H,34,37)(H,35,41)(H,36,42)(H,38,39)(H,43,44)(H4,30,31,32)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | VIOWWIDTZQCYFM-MUGJNUQGSA-N |
| XLogP | -3.13 |
| TPSA | 307.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|