C32H51N11O10 — CID 14441828
3-[[2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-[(1-carboxy-2-phenylethyl)amino]-4-oxobutanoic acid (PubChem CID 14441828) has the molecular formula C32H51N11O10 and a molecular weight of 749.83 g/mol. Its IUPAC name is 3-[[2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-[(1-carboxy-2-phenylethyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-[(1-carboxy-2-phenylethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14441828 |
| Molecular Formula | C32H51N11O10 |
| Molecular Weight | 749.83 g/mol |
| Exact Mass | 749.38 |
| IUPAC Name | 3-[[2-[[2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-4-[(1-carboxy-2-phenylethyl)amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C32H51N11O10/c33-13-5-4-9-19(34)27(48)41-21(11-12-24(35)44)29(50)42-20(10-6-14-38-32(36)37)28(49)39-17-25(45)40-22(16-26(46)47)30(51)43-23(31(52)53)15-18-7-2-1-3-8-18/h1-3,7-8,19-23H,4-6,9-17,33-34H2,(H2,35,44)(H,39,49)(H,40,45)(H,41,48)(H,42,50)(H,43,51)(H,46,47)(H,52,53)(H4,36,37,38) |
| InChIKey | DTOGDVZXNHMKBW-UHFFFAOYSA-N |
| XLogP | -4.38 |
| TPSA | 379.63 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.83 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|