C25H38N8O8 — CID 18243019
4-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-5-[(1-carboxy-2-phenylethyl)amino]-5-oxopentanoic acid (PubChem CID 18243019) has the molecular formula C25H38N8O8 and a molecular weight of 578.63 g/mol. Its IUPAC name is 4-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-5-[(1-carboxy-2-phenylethyl)amino]-5-oxopentanoic acid.
| Compound Name | 4-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-5-[(1-carboxy-2-phenylethyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18243019 |
| Molecular Formula | C25H38N8O8 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 4-[[5-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-5-[(1-carboxy-2-phenylethyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H38N8O8/c26-15(7-4-12-30-25(28)29)21(37)31-16(8-10-19(27)34)22(38)32-17(9-11-20(35)36)23(39)33-18(24(40)41)13-14-5-2-1-3-6-14/h1-3,5-6,15-18H,4,7-13,26H2,(H2,27,34)(H,31,37)(H,32,38)(H,33,39)(H,35,36)(H,40,41)(H4,28,29,30) |
| InChIKey | MLVNZPGKMFKGMW-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 295.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|