C20H31N7O5 — CID 18218845
5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid (PubChem CID 18218845) has the molecular formula C20H31N7O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18218845 |
| Molecular Formula | C20H31N7O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H31N7O5/c21-13(7-4-10-25-20(23)24)17(29)27-15(11-12-5-2-1-3-6-12)18(30)26-14(19(31)32)8-9-16(22)28/h1-3,5-6,13-15H,4,7-11,21H2,(H2,22,28)(H,26,30)(H,27,29)(H,31,32)(H4,23,24,25) |
| InChIKey | VEAIMHJZTIDCIH-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 229.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|