C16H27N7O9 — CID 175757732
(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]acetyl]amino]butanedioic acid (PubChem CID 175757732) has the molecular formula C16H27N7O9 and a molecular weight of 461.43 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 175757732 |
| Molecular Formula | C16H27N7O9 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]acetyl]amino]butanedioic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H27N7O9/c17-7(2-1-3-20-16(18)19)13(29)23-8(4-11(25)26)14(30)21-6-10(24)22-9(15(31)32)5-12(27)28/h7-9H,1-6,17H2,(H,21,30)(H,22,24)(H,23,29)(H,25,26)(H,27,28)(H,31,32)(H4,18,19,20)/t7-,8-,9-/m0/s1 |
| InChIKey | LSOURWFXKIWDPH-CIUDSAMLSA-N |
| XLogP | -4.51 |
| TPSA | 289.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|