C22H43N11O6 — CID 18484375
5-(diaminomethylideneamino)-2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoyl]amino]pentanoic acid (PubChem CID 18484375) has the molecular formula C22H43N11O6 and a molecular weight of 557.66 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 18484375 |
| Molecular Formula | C22H43N11O6 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.34 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[5-(diaminomethylideneamino)-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoyl]amino]pentanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H43N11O6/c1-11(2)16(33-17(35)12(23)7-8-15(24)34)19(37)31-13(5-3-9-29-21(25)26)18(36)32-14(20(38)39)6-4-10-30-22(27)28/h11-14,16H,3-10,23H2,1-2H3,(H2,24,34)(H,31,37)(H,32,36)(H,33,35)(H,38,39)(H4,25,26,29)(H4,27,28,30) |
| InChIKey | FIBZZORIEUFPFP-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 322.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|