C20H37N9O7 — CID 22701350
4-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoic acid (PubChem CID 22701350) has the molecular formula C20H37N9O7 and a molecular weight of 515.57 g/mol. Its IUPAC name is 4-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22701350 |
| Molecular Formula | C20H37N9O7 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 4-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H37N9O7/c1-9(2)15(18(34)28-12(19(35)36)8-14(23)31)29-17(33)11(4-3-7-26-20(24)25)27-16(32)10(21)5-6-13(22)30/h9-12,15H,3-8,21H2,1-2H3,(H2,22,30)(H2,23,31)(H,27,32)(H,28,34)(H,29,33)(H,35,36)(H4,24,25,26) |
| InChIKey | UKNXUNUOCNRHSN-UHFFFAOYSA-N |
| XLogP | -4.30 |
| TPSA | 301.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|