C19H35N9O8 — CID 22701290
4-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoic acid (PubChem CID 22701290) has the molecular formula C19H35N9O8 and a molecular weight of 517.54 g/mol. Its IUPAC name is 4-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22701290 |
| Molecular Formula | C19H35N9O8 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 4-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H35N9O8/c1-8(29)14(17(34)27-11(18(35)36)7-13(22)31)28-16(33)10(3-2-6-25-19(23)24)26-15(32)9(20)4-5-12(21)30/h8-11,14,29H,2-7,20H2,1H3,(H2,21,30)(H2,22,31)(H,26,32)(H,27,34)(H,28,33)(H,35,36)(H4,23,24,25) |
| InChIKey | CPGFFGAPAFEBJR-UHFFFAOYSA-N |
| XLogP | -5.57 |
| TPSA | 321.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | -5.57 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|