C17H32N8O7 — CID 22650492
4-amino-2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]propanoylamino]-4-oxobutanoic acid (PubChem CID 22650492) has the molecular formula C17H32N8O7 and a molecular weight of 460.49 g/mol. Its IUPAC name is 4-amino-2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]propanoylamino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]propanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22650492 |
| Molecular Formula | C17H32N8O7 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 4-amino-2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]propanoylamino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)C(NC(=O)C(N)CCCN=C(N)N)C(C)O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H32N8O7/c1-7(13(28)24-10(16(31)32)6-11(19)27)23-15(30)12(8(2)26)25-14(29)9(18)4-3-5-22-17(20)21/h7-10,12,26H,3-6,18H2,1-2H3,(H2,19,27)(H,23,30)(H,24,28)(H,25,29)(H,31,32)(H4,20,21,22) |
| InChIKey | KKLCGKFRQYQQRH-UHFFFAOYSA-N |
| XLogP | -4.82 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | -4.82 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|