C18H32N8O9 — CID 22650552
4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid (PubChem CID 22650552) has the molecular formula C18H32N8O9 and a molecular weight of 504.50 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22650552 |
| Molecular Formula | C18H32N8O9 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C18H32N8O9/c1-7(27)13(26-14(31)8(19)3-2-4-23-18(21)22)16(33)24-9(6-12(29)30)15(32)25-10(17(34)35)5-11(20)28/h7-10,13,27H,2-6,19H2,1H3,(H2,20,28)(H,24,33)(H,25,32)(H,26,31)(H,29,30)(H,34,35)(H4,21,22,23) |
| InChIKey | KWUVXGTVSWHHDT-UHFFFAOYSA-N |
| XLogP | -5.36 |
| TPSA | 315.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|