C15H29N7O5 — CID 145453757
(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-methylbutanoic acid (PubChem CID 145453757) has the molecular formula C15H29N7O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 145453757 |
| Molecular Formula | C15H29N7O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2S)-2-[[(2S)-4-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C15H29N7O5/c1-7(2)11(14(26)27)22-13(25)9(6-10(17)23)21-12(24)8(16)4-3-5-20-15(18)19/h7-9,11H,3-6,16H2,1-2H3,(H2,17,23)(H,21,24)(H,22,25)(H,26,27)(H4,18,19,20)/t8-,9-,11-/m0/s1 |
| InChIKey | ITVINTQUZMQWJR-QXEWZRGKSA-N |
| XLogP | -3.05 |
| TPSA | 229.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|