C24H38N8O7 — CID 18241688
2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoic acid (PubChem CID 18241688) has the molecular formula C24H38N8O7 and a molecular weight of 550.62 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18241688 |
| Molecular Formula | C24H38N8O7 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CC(N)=O)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H38N8O7/c1-12(2)19(23(38)39)32-22(37)16(10-13-5-7-14(33)8-6-13)31-21(36)17(11-18(26)34)30-20(35)15(25)4-3-9-29-24(27)28/h5-8,12,15-17,19,33H,3-4,9-11,25H2,1-2H3,(H2,26,34)(H,30,35)(H,31,36)(H,32,37)(H,38,39)(H4,27,28,29) |
| InChIKey | DYUFCDCPYKZPHS-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|