C25H39N7O8 — CID 18263231
4-amino-5-[[1-[[1-[(1-carboxy-2-methylpropyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18263231) has the molecular formula C25H39N7O8 and a molecular weight of 565.63 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-[(1-carboxy-2-methylpropyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-[(1-carboxy-2-methylpropyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18263231 |
| Molecular Formula | C25H39N7O8 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 4-amino-5-[[1-[[1-[(1-carboxy-2-methylpropyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H39N7O8/c1-13(2)20(24(39)40)32-23(38)18(12-14-5-7-15(33)8-6-14)31-22(37)17(4-3-11-29-25(27)28)30-21(36)16(26)9-10-19(34)35/h5-8,13,16-18,20,33H,3-4,9-12,26H2,1-2H3,(H,30,36)(H,31,37)(H,32,38)(H,34,35)(H,39,40)(H4,27,28,29) |
| InChIKey | IDGVOAFBXWEVKX-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|