C24H39N7O7 — CID 22652057
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22652057) has the molecular formula C24H39N7O7 and a molecular weight of 537.62 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22652057 |
| Molecular Formula | C24H39N7O7 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C24H39N7O7/c1-12(2)18(30-20(34)16(25)5-4-10-28-24(26)27)22(36)29-17(11-14-6-8-15(33)9-7-14)21(35)31-19(13(3)32)23(37)38/h6-9,12-13,16-19,32-33H,4-5,10-11,25H2,1-3H3,(H,29,36)(H,30,34)(H,31,35)(H,37,38)(H4,26,27,28) |
| InChIKey | ITZVBBGOHSMSKI-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|