C23H37N7O8 — CID 19950742
2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 19950742) has the molecular formula C23H37N7O8 and a molecular weight of 539.59 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19950742 |
| Molecular Formula | C23H37N7O8 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1ccc(O)cc1)C(C)O)C(=O)O |
| InChI | InChI=1S/C23H37N7O8/c1-11(31)17(21(36)30-18(12(2)32)22(37)38)29-20(35)16(4-3-9-27-23(25)26)28-19(34)15(24)10-13-5-7-14(33)8-6-13/h5-8,11-12,15-18,31-33H,3-4,9-10,24H2,1-2H3,(H,28,34)(H,29,35)(H,30,36)(H,37,38)(H4,25,26,27) |
| InChIKey | HAUWXCJMARYHRM-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 275.71 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|