C22H35N7O7S — CID 19951641
2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 19951641) has the molecular formula C22H35N7O7S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19951641 |
| Molecular Formula | C22H35N7O7S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CS)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H35N7O7S/c1-11(30)17(21(35)36)29-19(33)15(3-2-8-26-22(24)25)27-20(34)16(10-37)28-18(32)14(23)9-12-4-6-13(31)7-5-12/h4-7,11,14-17,30-31,37H,2-3,8-10,23H2,1H3,(H,27,34)(H,28,32)(H,29,33)(H,35,36)(H4,24,25,26) |
| InChIKey | SAQXUDZGMWYAHN-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|