C25H41N7O7 — CID 22703219
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22703219) has the molecular formula C25H41N7O7 and a molecular weight of 551.65 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22703219 |
| Molecular Formula | C25H41N7O7 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C25H41N7O7/c1-13(2)11-17(26)21(35)30-18(5-4-10-29-25(27)28)22(36)31-19(12-15-6-8-16(34)9-7-15)23(37)32-20(14(3)33)24(38)39/h6-9,13-14,17-20,33-34H,4-5,10-12,26H2,1-3H3,(H,30,35)(H,31,36)(H,32,37)(H,38,39)(H4,27,28,29) |
| InChIKey | LDTYTZSKOMMAAC-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|