C24H39N7O7 — CID 22703161
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 22703161) has the molecular formula C24H39N7O7 and a molecular weight of 537.62 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 22703161 |
| Molecular Formula | C24H39N7O7 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H39N7O7/c1-13(2)10-16(25)20(34)29-17(4-3-9-28-24(26)27)21(35)31-19(12-32)22(36)30-18(23(37)38)11-14-5-7-15(33)8-6-14/h5-8,13,16-19,32-33H,3-4,9-12,25H2,1-2H3,(H,29,34)(H,30,36)(H,31,35)(H,37,38)(H4,26,27,28) |
| InChIKey | GIBVJAJFLRZIAN-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|