C23H36N8O8 — CID 15980048
(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 15980048) has the molecular formula C23H36N8O8 and a molecular weight of 552.59 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 15980048 |
| Molecular Formula | C23H36N8O8 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(=O)CC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C23H36N8O8/c24-14(7-8-18(25)34)19(35)31-17(11-32)21(37)29-15(2-1-9-28-23(26)27)20(36)30-16(22(38)39)10-12-3-5-13(33)6-4-12/h3-6,14-17,32-33H,1-2,7-11,24H2,(H2,25,34)(H,29,37)(H,30,36)(H,31,35)(H,38,39)(H4,26,27,28)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | IDVWTNBWHIOGLU-QAETUUGQSA-N |
| XLogP | -3.89 |
| TPSA | 298.57 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|