C27H46N8O6 — CID 18301752
2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18301752) has the molecular formula C27H46N8O6 and a molecular weight of 578.72 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18301752 |
| Molecular Formula | C27H46N8O6 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H46N8O6/c1-16(2)14-19(29)23(37)35-22(15-17-8-10-18(36)11-9-17)25(39)33-20(6-3-4-12-28)24(38)34-21(26(40)41)7-5-13-32-27(30)31/h8-11,16,19-22,36H,3-7,12-15,28-29H2,1-2H3,(H,33,39)(H,34,38)(H,35,37)(H,40,41)(H4,30,31,32) |
| InChIKey | MLJRIFNCNLNDIV-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|