C17H35N7O4 — CID 11963124
(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 11963124) has the molecular formula C17H35N7O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 11963124 |
| Molecular Formula | C17H35N7O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H35N7O4/c1-10(2)13(24-14(25)11(19)6-3-4-8-18)15(26)23-12(16(27)28)7-5-9-22-17(20)21/h10-13H,3-9,18-19H2,1-2H3,(H,23,26)(H,24,25)(H,27,28)(H4,20,21,22)/t11-,12-,13-/m0/s1 |
| InChIKey | OHXUUQDOBQKSNB-AVGNSLFASA-N |
| XLogP | -1.79 |
| TPSA | 211.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|