C21H40N8O7 — CID 18251272
2-[[2-[[6-amino-2-[(2-amino-3-carboxypropanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18251272) has the molecular formula C21H40N8O7 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-carboxypropanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-carboxypropanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18251272 |
| Molecular Formula | C21H40N8O7 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-carboxypropanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H40N8O7/c1-11(2)16(19(34)28-14(20(35)36)7-5-9-26-21(24)25)29-18(33)13(6-3-4-8-22)27-17(32)12(23)10-15(30)31/h11-14,16H,3-10,22-23H2,1-2H3,(H,27,32)(H,28,34)(H,29,33)(H,30,31)(H,35,36)(H4,24,25,26) |
| InChIKey | CWBXLHPUXXDFNZ-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|