C18H33N7O7S — CID 18254167
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18254167) has the molecular formula C18H33N7O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18254167 |
| Molecular Formula | C18H33N7O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CC(=O)O)C(=O)NC(CS)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H33N7O7S/c1-8(2)13(25-14(28)9(19)6-12(26)27)16(30)24-11(7-33)15(29)23-10(17(31)32)4-3-5-22-18(20)21/h8-11,13,33H,3-7,19H2,1-2H3,(H,23,29)(H,24,30)(H,25,28)(H,26,27)(H,31,32)(H4,20,21,22) |
| InChIKey | GEQNMSHLEJJFMV-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|