C19H35N7O7 — CID 175734257
(3S)-3-amino-4-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxypropyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 175734257) has the molecular formula C19H35N7O7 and a molecular weight of 473.53 g/mol. Its IUPAC name is (3S)-3-amino-4-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxypropyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxypropyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175734257 |
| Molecular Formula | C19H35N7O7 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-1-[[(2S)-1-[[(1S)-1-carboxypropyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC[C@H](NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(=O)O |
| InChI | InChI=1S/C19H35N7O7/c1-4-11(18(32)33)24-17(31)14(9(2)3)26-16(30)12(6-5-7-23-19(21)22)25-15(29)10(20)8-13(27)28/h9-12,14H,4-8,20H2,1-3H3,(H,24,31)(H,25,29)(H,26,30)(H,27,28)(H,32,33)(H4,21,22,23)/t10-,11-,12-,14-/m0/s1 |
| InChIKey | CGLHRCIMTBDHGV-MNXVOIDGSA-N |
| XLogP | -2.55 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|