C17H33N7O5S — CID 18234554
2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18234554) has the molecular formula C17H33N7O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18234554 |
| Molecular Formula | C17H33N7O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(N)C(=O)NC(CS)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)C |
| InChI | InChI=1S/C17H33N7O5S/c1-8(2)12(24-14(26)11(7-30)23-13(25)9(3)18)15(27)22-10(16(28)29)5-4-6-21-17(19)20/h8-12,30H,4-7,18H2,1-3H3,(H,22,27)(H,23,25)(H,24,26)(H,28,29)(H4,19,20,21) |
| InChIKey | DIBCAYFVTMWWNJ-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|