C16H29N7O7S2 — CID 18248182
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18248182) has the molecular formula C16H29N7O7S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18248182 |
| Molecular Formula | C16H29N7O7S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-sulfanylpropanoyl]amino]-3-sulfanylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CS)NC(=O)C(CS)NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H29N7O7S2/c17-7(4-11(24)25)12(26)22-9(5-31)14(28)23-10(6-32)13(27)21-8(15(29)30)2-1-3-20-16(18)19/h7-10,31-32H,1-6,17H2,(H,21,27)(H,22,26)(H,23,28)(H,24,25)(H,29,30)(H4,18,19,20) |
| InChIKey | AJYXTESYIABIPO-UHFFFAOYSA-N |
| XLogP | -3.76 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|