C23H47N11O5 — CID 18303086
2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18303086) has the molecular formula C23H47N11O5 and a molecular weight of 557.70 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18303086 |
| Molecular Formula | C23H47N11O5 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.38 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H47N11O5/c1-13(2)17(20(37)33-16(21(38)39)9-6-12-31-23(28)29)34-19(36)15(8-5-11-30-22(26)27)32-18(35)14(25)7-3-4-10-24/h13-17H,3-12,24-25H2,1-2H3,(H,32,35)(H,33,37)(H,34,36)(H,38,39)(H4,26,27,30)(H4,28,29,31) |
| InChIKey | HZMCUVZNLYZAAQ-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 305.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|