C20H40N10O6 — CID 18241304
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18241304) has the molecular formula C20H40N10O6 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18241304 |
| Molecular Formula | C20H40N10O6 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C20H40N10O6/c1-10(2)14(17(34)29-13(9-31)18(35)36)30-16(33)12(6-4-8-27-20(24)25)28-15(32)11(21)5-3-7-26-19(22)23/h10-14,31H,3-9,21H2,1-2H3,(H,28,32)(H,29,34)(H,30,33)(H,35,36)(H4,22,23,26)(H4,24,25,27) |
| InChIKey | HMRULYWEVGDQCL-UHFFFAOYSA-N |
| XLogP | -4.39 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|