C19H37N7O6 — CID 18297816
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid (PubChem CID 18297816) has the molecular formula C19H37N7O6 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18297816 |
| Molecular Formula | C19H37N7O6 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)O)C(C)O |
| InChI | InChI=1S/C19H37N7O6/c1-5-9(2)13(20)16(29)26-14(11(4)27)17(30)25-12(7-6-8-23-19(21)22)15(28)24-10(3)18(31)32/h9-14,27H,5-8,20H2,1-4H3,(H,24,28)(H,25,30)(H,26,29)(H,31,32)(H4,21,22,23) |
| InChIKey | PZUWIYIRSPVUKV-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|