C22H43N7O5S2 — CID 18310832
2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18310832) has the molecular formula C22H43N7O5S2 and a molecular weight of 549.76 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18310832 |
| Molecular Formula | C22H43N7O5S2 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCSC)C(=O)NC(CCSC)C(=O)O |
| InChI | InChI=1S/C22H43N7O5S2/c1-5-13(2)17(20(32)28-16(21(33)34)9-12-36-4)29-19(31)15(7-6-10-26-22(24)25)27-18(30)14(23)8-11-35-3/h13-17H,5-12,23H2,1-4H3,(H,27,30)(H,28,32)(H,29,31)(H,33,34)(H4,24,25,26) |
| InChIKey | WWONNSBAFXHJSG-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|