C23H46N8O5S — CID 19997342
2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19997342) has the molecular formula C23H46N8O5S and a molecular weight of 546.74 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19997342 |
| Molecular Formula | C23H46N8O5S |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCSC)C(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H46N8O5S/c1-4-14(2)18(31-19(32)15(25)10-13-37-3)21(34)29-16(8-5-6-11-24)20(33)30-17(22(35)36)9-7-12-28-23(26)27/h14-18H,4-13,24-25H2,1-3H3,(H,29,34)(H,30,33)(H,31,32)(H,35,36)(H4,26,27,28) |
| InChIKey | PGQSITOJHXNSJB-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|