C21H39N7O7S — CID 18244335
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid (PubChem CID 18244335) has the molecular formula C21H39N7O7S and a molecular weight of 533.65 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18244335 |
| Molecular Formula | C21H39N7O7S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCSC)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H39N7O7S/c1-4-11(2)16(28-17(31)12(22)6-5-8-25-21(23)24)19(33)26-13(7-9-36-3)18(32)27-14(20(34)35)10-15(29)30/h11-14,16H,4-10,22H2,1-3H3,(H,26,33)(H,27,32)(H,28,31)(H,29,30)(H,34,35)(H4,23,24,25) |
| InChIKey | UHVPMTDGCGFPIE-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|