C23H46N10O5S — CID 18245309
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid (PubChem CID 18245309) has the molecular formula C23H46N10O5S and a molecular weight of 574.75 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18245309 |
| Molecular Formula | C23H46N10O5S |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCSC)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H46N10O5S/c1-4-13(2)17(21(37)38)33-20(36)15(8-6-11-30-23(27)28)32-19(35)16(9-12-39-3)31-18(34)14(24)7-5-10-29-22(25)26/h13-17H,4-12,24H2,1-3H3,(H,31,34)(H,32,35)(H,33,36)(H,37,38)(H4,25,26,29)(H4,27,28,30) |
| InChIKey | XFGFIXXECZDNDP-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 279.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|