C21H40N8O6S — CID 18245329
2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoic acid (PubChem CID 18245329) has the molecular formula C21H40N8O6S and a molecular weight of 532.67 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18245329 |
| Molecular Formula | C21H40N8O6S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(CCSC)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H40N8O6S/c1-4-11(2)16(20(34)35)29-19(33)14(10-15(23)30)28-18(32)13(7-9-36-3)27-17(31)12(22)6-5-8-26-21(24)25/h11-14,16H,4-10,22H2,1-3H3,(H2,23,30)(H,27,31)(H,28,32)(H,29,33)(H,34,35)(H4,24,25,26) |
| InChIKey | WULRDDLJOOKASG-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|