C21H33N7O7 — CID 18743133
2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18743133) has the molecular formula C21H33N7O7 and a molecular weight of 495.54 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18743133 |
| Molecular Formula | C21H33N7O7 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CO)NC(=O)C(N)CO)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H33N7O7/c22-13(10-29)17(31)28-16(11-30)19(33)26-14(7-4-8-25-21(23)24)18(32)27-15(20(34)35)9-12-5-2-1-3-6-12/h1-3,5-6,13-16,29-30H,4,7-11,22H2,(H,26,33)(H,27,32)(H,28,31)(H,34,35)(H4,23,24,25) |
| InChIKey | DSCLJJBGDMCSMD-UHFFFAOYSA-N |
| XLogP | -3.87 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|