C23H35N7O8 — CID 18263165
4-amino-5-[[1-[[1-[(1-carboxy-2-phenylethyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18263165) has the molecular formula C23H35N7O8 and a molecular weight of 537.57 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-[(1-carboxy-2-phenylethyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-[(1-carboxy-2-phenylethyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18263165 |
| Molecular Formula | C23H35N7O8 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 4-amino-5-[[1-[[1-[(1-carboxy-2-phenylethyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)CCC(=O)O)C(=O)NC(CO)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H35N7O8/c24-14(8-9-18(32)33)19(34)28-15(7-4-10-27-23(25)26)20(35)30-17(12-31)21(36)29-16(22(37)38)11-13-5-2-1-3-6-13/h1-3,5-6,14-17,31H,4,7-12,24H2,(H,28,34)(H,29,36)(H,30,35)(H,32,33)(H,37,38)(H4,25,26,27) |
| InChIKey | ZKBYRTOCYUMNES-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|