C18H28N6O5 — CID 175717157
(2S)-2-[[(2R)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 175717157) has the molecular formula C18H28N6O5 and a molecular weight of 408.46 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 175717157 |
| Molecular Formula | C18H28N6O5 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(N)=NCCC[C@@H](N)C(=O)N[C@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H28N6O5/c19-12(7-4-8-22-18(20)21)15(26)24-14(10-25)16(27)23-13(17(28)29)9-11-5-2-1-3-6-11/h1-3,5-6,12-14,25H,4,7-10,19H2,(H,23,27)(H,24,26)(H,28,29)(H4,20,21,22)/t12-,13+,14-/m1/s1 |
| InChIKey | JPAWCMXVNZPJLO-HZSPNIEDSA-N |
| XLogP | -2.34 |
| TPSA | 206.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|