C22H33N7O8 — CID 18242022
3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-[[1-[(1-carboxy-2-phenylethyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18242022) has the molecular formula C22H33N7O8 and a molecular weight of 523.55 g/mol. Its IUPAC name is 3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-[[1-[(1-carboxy-2-phenylethyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-[[1-[(1-carboxy-2-phenylethyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18242022 |
| Molecular Formula | C22H33N7O8 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 3-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-[[1-[(1-carboxy-2-phenylethyl)amino]-3-hydroxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CC(=O)O)C(=O)NC(CO)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H33N7O8/c23-13(7-4-8-26-22(24)25)18(33)27-14(10-17(31)32)19(34)29-16(11-30)20(35)28-15(21(36)37)9-12-5-2-1-3-6-12/h1-3,5-6,13-16,30H,4,7-11,23H2,(H,27,33)(H,28,35)(H,29,34)(H,31,32)(H,36,37)(H4,24,25,26) |
| InChIKey | ONNLYRSLGNUKOI-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|