C23H37N7O6S — CID 18310952
2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18310952) has the molecular formula C23H37N7O6S and a molecular weight of 539.66 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18310952 |
| Molecular Formula | C23H37N7O6S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H37N7O6S/c1-37-11-9-15(24)19(32)28-16(8-5-10-27-23(25)26)20(33)30-18(13-31)21(34)29-17(22(35)36)12-14-6-3-2-4-7-14/h2-4,6-7,15-18,31H,5,8-13,24H2,1H3,(H,28,32)(H,29,34)(H,30,33)(H,35,36)(H4,25,26,27) |
| InChIKey | OOFOUKZWKMVGKM-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|