C25H41N7O5S — CID 18310918
2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid (PubChem CID 18310918) has the molecular formula C25H41N7O5S and a molecular weight of 551.71 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18310918 |
| Molecular Formula | C25H41N7O5S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C25H41N7O5S/c1-15(2)20(24(36)37)32-23(35)19(14-16-8-5-4-6-9-16)31-22(34)18(10-7-12-29-25(27)28)30-21(33)17(26)11-13-38-3/h4-6,8-9,15,17-20H,7,10-14,26H2,1-3H3,(H,30,33)(H,31,34)(H,32,35)(H,36,37)(H4,27,28,29) |
| InChIKey | MCOGQJOXBUJLMB-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|