C26H44N8O5 — CID 18245162
2-[[2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid (PubChem CID 18245162) has the molecular formula C26H44N8O5 and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18245162 |
| Molecular Formula | C26H44N8O5 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 2-[[2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(CCCCN)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H44N8O5/c1-16(2)21(25(38)39)34-24(37)20(15-17-9-4-3-5-10-17)33-23(36)19(12-6-7-13-27)32-22(35)18(28)11-8-14-31-26(29)30/h3-5,9-10,16,18-21H,6-8,11-15,27-28H2,1-2H3,(H,32,35)(H,33,36)(H,34,37)(H,38,39)(H4,29,30,31) |
| InChIKey | PHYGVRDJEUSRDB-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|