C24H37N7O7 — CID 18246058
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]butanedioic acid (PubChem CID 18246058) has the molecular formula C24H37N7O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18246058 |
| Molecular Formula | C24H37N7O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]butanedioic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H37N7O7/c1-13(2)19(22(36)30-17(23(37)38)12-18(32)33)31-21(35)16(11-14-7-4-3-5-8-14)29-20(34)15(25)9-6-10-28-24(26)27/h3-5,7-8,13,15-17,19H,6,9-12,25H2,1-2H3,(H,29,34)(H,30,36)(H,31,35)(H,32,33)(H,37,38)(H4,26,27,28) |
| InChIKey | BQTCRGHAEADYTG-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|