C23H37N7O5S — CID 22651945
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 22651945) has the molecular formula C23H37N7O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 22651945 |
| Molecular Formula | C23H37N7O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C23H37N7O5S/c1-13(2)18(30-19(31)15(24)9-6-10-27-23(25)26)21(33)28-16(11-14-7-4-3-5-8-14)20(32)29-17(12-36)22(34)35/h3-5,7-8,13,15-18,36H,6,9-12,24H2,1-2H3,(H,28,33)(H,29,32)(H,30,31)(H,34,35)(H4,25,26,27) |
| InChIKey | WLIBMYOQKWYAIV-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|