C21H33N7O5S — CID 18240613
2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18240613) has the molecular formula C21H33N7O5S and a molecular weight of 495.61 g/mol. Its IUPAC name is 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18240613 |
| Molecular Formula | C21H33N7O5S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CS)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H33N7O5S/c1-12(26-18(30)14(22)8-5-9-25-21(23)24)17(29)28-16(11-34)19(31)27-15(20(32)33)10-13-6-3-2-4-7-13/h2-4,6-7,12,14-16,34H,5,8-11,22H2,1H3,(H,26,30)(H,27,31)(H,28,29)(H,32,33)(H4,23,24,25) |
| InChIKey | QPEBZAUUWXRAPI-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|