C24H40N10O5 — CID 18240779
2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18240779) has the molecular formula C24H40N10O5 and a molecular weight of 548.65 g/mol. Its IUPAC name is 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18240779 |
| Molecular Formula | C24H40N10O5 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | 2-[[2-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H40N10O5/c1-14(32-20(36)16(25)9-5-11-30-23(26)27)19(35)34-18(13-15-7-3-2-4-8-15)21(37)33-17(22(38)39)10-6-12-31-24(28)29/h2-4,7-8,14,16-18H,5-6,9-13,25H2,1H3,(H,32,36)(H,33,37)(H,34,35)(H,38,39)(H4,26,27,30)(H4,28,29,31) |
| InChIKey | DCMSSYKMWHMUBH-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 279.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|