C21H34N6O4 — CID 18218849
2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 18218849) has the molecular formula C21H34N6O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18218849 |
| Molecular Formula | C21H34N6O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H34N6O4/c1-13(2)11-17(20(30)31)27-19(29)16(12-14-7-4-3-5-8-14)26-18(28)15(22)9-6-10-25-21(23)24/h3-5,7-8,13,15-17H,6,9-12,22H2,1-2H3,(H,26,28)(H,27,29)(H,30,31)(H4,23,24,25) |
| InChIKey | UGZUVYDKAYNCII-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|