C23H37N7O5 — CID 18244758
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]acetic acid (PubChem CID 18244758) has the molecular formula C23H37N7O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18244758 |
| Molecular Formula | C23H37N7O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]acetic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H37N7O5/c1-14(2)11-17(29-20(33)16(24)9-6-10-27-23(25)26)22(35)30-18(21(34)28-13-19(31)32)12-15-7-4-3-5-8-15/h3-5,7-8,14,16-18H,6,9-13,24H2,1-2H3,(H,28,34)(H,29,33)(H,30,35)(H,31,32)(H4,25,26,27) |
| InChIKey | HFWFNAQDBLIQDN-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|