C14H28N6O4 — CID 18218795
2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]acetic acid (PubChem CID 18218795) has the molecular formula C14H28N6O4 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18218795 |
| Molecular Formula | C14H28N6O4 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C14H28N6O4/c1-8(2)6-10(13(24)19-7-11(21)22)20-12(23)9(15)4-3-5-18-14(16)17/h8-10H,3-7,15H2,1-2H3,(H,19,24)(H,20,23)(H,21,22)(H4,16,17,18) |
| InChIKey | YBZMTKUDWXZLIX-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|