C18H36N10O6 — CID 22650517
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 22650517) has the molecular formula C18H36N10O6 and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22650517 |
| Molecular Formula | C18H36N10O6 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C18H36N10O6/c1-9(29)13(28-14(32)10(19)4-2-6-24-17(20)21)16(34)27-11(5-3-7-25-18(22)23)15(33)26-8-12(30)31/h9-11,13,29H,2-8,19H2,1H3,(H,26,33)(H,27,34)(H,28,32)(H,30,31)(H4,20,21,24)(H4,22,23,25) |
| InChIKey | VQEKGLBOAGZSBR-UHFFFAOYSA-N |
| XLogP | -5.03 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | -5.03 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|