C14H29N7O4 — CID 145456579
2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 145456579) has the molecular formula C14H29N7O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 145456579 |
| Molecular Formula | C14H29N7O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C14H29N7O4/c15-6-2-1-4-9(16)12(24)21-10(5-3-7-19-14(17)18)13(25)20-8-11(22)23/h9-10H,1-8,15-16H2,(H,20,25)(H,21,24)(H,22,23)(H4,17,18,19)/t9-,10-/m0/s1 |
| InChIKey | GAOJCVKPIGHTGO-UWVGGRQHSA-N |
| XLogP | -2.82 |
| TPSA | 211.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|